About 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole
5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole (PubChem CID 98471266) has the molecular formula C15H12I2N2O4
and a molecular weight of 538.08 g/mol. Its IUPAC name is 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole |
| PubChem CID | 98471266 |
| Molecular Formula | C15H12I2N2O4 |
| Molecular Weight | 538.08 g/mol |
| Exact Mass | 537.89 |
| IUPAC Name | 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole |
| SMILES | C=CCOc1c(I)cc(I)cc1/C=C\c1onc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12I2N2O4/c1-3-6-22-15-10(7-11(16)8-12(15)17)4-5-13-14(19(20)21)9(2)18-23-13/h3-5,7-8H,1,6H2,2H3/b5-4- |
| InChIKey | REXJHVRTOBWROX-PLNGDYQASA-N |
| XLogP | 4.84 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 538.08 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole?
The IUPAC name of 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole (CID 98471266) is 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole.
What is the SMILES notation for 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole?
The canonical SMILES for 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole is C=CCOc1c(I)cc(I)cc1/C=C\c1onc(C)c1[N+](=O)[O-].
What is the InChIKey of 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole?
The InChIKey is REXJHVRTOBWROX-PLNGDYQASA-N. The full InChI is InChI=1S/C15H12I2N2O4/c1-3-6-22-15-10(7-11(16)8-12(15)17)4-5-13-14(19(20)21)9(2)18-23-13/h3-5,7-8H,1,6H2,2H3/b5-4-.
What are the key properties of 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole?
5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole has a molecular weight of 538.08 g/mol, XLogP of 4.84, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-2-(3,5-diiodo-2-prop-2-enoxyphenyl)ethenyl]-3-methyl-4-nitro-1,2-oxazole is sourced from PubChem (CID 98471266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).