C18H20N2O5 — CID 98472801
(1R,2S,3R,4R)-3-[[4-[methoxycarbonyl(methyl)amino]phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98472801) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[[4-[methoxycarbonyl(methyl)amino]phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-3-[[4-[methoxycarbonyl(methyl)amino]phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98472801 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (1R,2S,3R,4R)-3-[[4-[methoxycarbonyl(methyl)amino]phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | COC(=O)N(C)c1ccc(NC(=O)[C@H]2[C@@H](C(=O)O)[C@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C18H20N2O5/c1-20(18(24)25-2)13-7-5-12(6-8-13)19-16(21)14-10-3-4-11(9-10)15(14)17(22)23/h3-8,10-11,14-15H,9H2,1-2H3,(H,19,21)(H,22,23)/t10-,11-,14+,15-/m0/s1 |
| InChIKey | JOELSECMKLMYNL-AZHAFVHUSA-N |
| XLogP | 2.35 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|