C5H7NO2 — CID 98474157
(5R)-5-methylpyrrolidine-2,4-dione (PubChem CID 98474157) has the molecular formula C5H7NO2 and a molecular weight of 113.12 g/mol. Its IUPAC name is (5R)-5-methylpyrrolidine-2,4-dione.
| Compound Name | (5R)-5-methylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 98474157 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | (5R)-5-methylpyrrolidine-2,4-dione |
| SMILES | C[C@H]1NC(=O)CC1=O |
| InChI | InChI=1S/C5H7NO2/c1-3-4(7)2-5(8)6-3/h3H,2H2,1H3,(H,6,8)/t3-/m1/s1 |
| InChIKey | VKKNQZBZGSFRCA-GSVOUGTGSA-N |
| XLogP | -0.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|