C24H30N2O3 — CID 98474801
(4aS,5aR,8aR,13aR,14S,15aR,15bR)-10,11-dimethoxy-14-methyl-2,4a,5,5a,7,8,13a,14,15,15a,15b,16-dodecahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline (PubChem CID 98474801) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is (4aS,5aR,8aR,13aR,14S,15aR,15bR)-10,11-dimethoxy-14-methyl-2,4a,5,5a,7,8,13a,14,15,15a,15b,16-dodecahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline.
| Compound Name | (4aS,5aR,8aR,13aR,14S,15aR,15bR)-10,11-dimethoxy-14-methyl-2,4a,5,5a,7,8,13a,14,15,15a,15b,16-dodecahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline |
|---|---|
| PubChem CID | 98474801 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (4aS,5aR,8aR,13aR,14S,15aR,15bR)-10,11-dimethoxy-14-methyl-2,4a,5,5a,7,8,13a,14,15,15a,15b,16-dodecahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline |
| SMILES | COc1cc2c(cc1OC)[C@@]13CCN4CC5=CCO[C@@H]6C[C@H](C)N2[C@@H]1[C@H]6[C@@H]5C[C@@H]43 |
| InChI | InChI=1S/C24H30N2O3/c1-13-8-20-22-15-9-21-24(5-6-25(21)12-14(15)4-7-29-20)16-10-18(27-2)19(28-3)11-17(16)26(13)23(22)24/h4,10-11,13,15,20-23H,5-9,12H2,1-3H3/t13-,15+,20+,21+,22-,23+,24+/m0/s1 |
| InChIKey | ZBPJQPJRBAWPTN-WIPOPZONSA-N |
| XLogP | 2.97 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|