C16H23NO2 — CID 98474954
(Z)-3-(2-methoxyphenyl)-N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]prop-2-en-1-amine (PubChem CID 98474954) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (Z)-3-(2-methoxyphenyl)-N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]prop-2-en-1-amine.
| Compound Name | (Z)-3-(2-methoxyphenyl)-N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 98474954 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (Z)-3-(2-methoxyphenyl)-N-[(1R)-1-[(2S)-oxolan-2-yl]ethyl]prop-2-en-1-amine |
| SMILES | COc1ccccc1/C=C\CN[C@H](C)[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H23NO2/c1-13(15-10-6-12-19-15)17-11-5-8-14-7-3-4-9-16(14)18-2/h3-5,7-9,13,15,17H,6,10-12H2,1-2H3/b8-5-/t13-,15+/m1/s1 |
| InChIKey | SJNWXVCHVFBTGA-DBVFPWQWSA-N |
| XLogP | 2.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |