C12H16Cl4 — CID 98475278
cis-(2R,3R)-1,1-dichloro-2-[(Z)-2-[(1R)-2,2-dichloro-3,3-dimethylcyclopropyl]ethenyl]-2,3-dimethylcyclopropane (PubChem CID 98475278) has the molecular formula C12H16Cl4 and a molecular weight of 302.07 g/mol. Its IUPAC name is cis-(2R,3R)-1,1-dichloro-2-[(Z)-2-[(1R)-2,2-dichloro-3,3-dimethylcyclopropyl]ethenyl]-2,3-dimethylcyclopropane.
| Compound Name | cis-(2R,3R)-1,1-dichloro-2-[(Z)-2-[(1R)-2,2-dichloro-3,3-dimethylcyclopropyl]ethenyl]-2,3-dimethylcyclopropane |
|---|---|
| PubChem CID | 98475278 |
| Molecular Formula | C12H16Cl4 |
| Molecular Weight | 302.07 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | cis-(2R,3R)-1,1-dichloro-2-[(Z)-2-[(1R)-2,2-dichloro-3,3-dimethylcyclopropyl]ethenyl]-2,3-dimethylcyclopropane |
| SMILES | C[C@H]1C(Cl)(Cl)[C@]1(C)/C=C\[C@@H]1C(C)(C)C1(Cl)Cl |
| InChI | InChI=1S/C12H16Cl4/c1-7-10(4,11(7,13)14)6-5-8-9(2,3)12(8,15)16/h5-8H,1-4H3/b6-5-/t7-,8-,10-/m1/s1 |
| InChIKey | VCDQRKTVZNZMPA-HYKVNZFTSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.07 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|