C25H33N5O2S — CID 98475761
N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2-[(R)-(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfinyl]acetamide (PubChem CID 98475761) has the molecular formula C25H33N5O2S and a molecular weight of 467.64 g/mol. Its IUPAC name is N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2-[(R)-(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfinyl]acetamide.
| Compound Name | N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2-[(R)-(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfinyl]acetamide |
|---|---|
| PubChem CID | 98475761 |
| Molecular Formula | C25H33N5O2S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2-[(R)-(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfinyl]acetamide |
| SMILES | C[C@H]1CCCCN1CCCNC(=O)C[S@](=O)Cc1cnn(-c2ccccc2)c1-n1cccc1 |
| InChI | InChI=1S/C25H33N5O2S/c1-21-10-5-6-14-28(21)17-9-13-26-24(31)20-33(32)19-22-18-27-30(23-11-3-2-4-12-23)25(22)29-15-7-8-16-29/h2-4,7-8,11-12,15-16,18,21H,5-6,9-10,13-14,17,19-20H2,1H3,(H,26,31)/t21-,33+/m0/s1 |
| InChIKey | SUYOHEFFNWVPNF-AUSOSSAASA-N |
| XLogP | 3.29 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|