C17H20N2O4 — CID 98476819
(4-nitrophenyl)-[(1S,2R,4S,5S)-5,7,7-trimethyl-6-oxa-3-azatricyclo[3.2.2.02,4]nonan-3-yl]methanone (PubChem CID 98476819) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (4-nitrophenyl)-[(1S,2R,4S,5S)-5,7,7-trimethyl-6-oxa-3-azatricyclo[3.2.2.02,4]nonan-3-yl]methanone.
| Compound Name | (4-nitrophenyl)-[(1S,2R,4S,5S)-5,7,7-trimethyl-6-oxa-3-azatricyclo[3.2.2.02,4]nonan-3-yl]methanone |
|---|---|
| PubChem CID | 98476819 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (4-nitrophenyl)-[(1S,2R,4S,5S)-5,7,7-trimethyl-6-oxa-3-azatricyclo[3.2.2.02,4]nonan-3-yl]methanone |
| SMILES | CC1(C)O[C@@]2(C)CC[C@H]1[C@@H]1[C@@H]2N1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H20N2O4/c1-16(2)12-8-9-17(3,23-16)14-13(12)18(14)15(20)10-4-6-11(7-5-10)19(21)22/h4-7,12-14H,8-9H2,1-3H3/t12-,13+,14-,17-,18?/m0/s1 |
| InChIKey | WKHNLBMOCOAPPQ-XPXSQLCNSA-N |
| XLogP | 2.77 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|