C12H9Cl6I — CID 98478186
(1R,2R,3S,6S,7S,8S,9R)-3,4,5,6,12,12-hexachloro-9-iodotetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 98478186) has the molecular formula C12H9Cl6I and a molecular weight of 492.83 g/mol. Its IUPAC name is (1R,2R,3S,6S,7S,8S,9R)-3,4,5,6,12,12-hexachloro-9-iodotetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | (1R,2R,3S,6S,7S,8S,9R)-3,4,5,6,12,12-hexachloro-9-iodotetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 98478186 |
| Molecular Formula | C12H9Cl6I |
| Molecular Weight | 492.83 g/mol |
| Exact Mass | 489.79 |
| IUPAC Name | (1R,2R,3S,6S,7S,8S,9R)-3,4,5,6,12,12-hexachloro-9-iodotetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)[C@@H]3[C@@H]4C[C@H](C[C@H]4I)[C@H]3[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C12H9Cl6I/c13-8-9(14)11(16)7-4-1-3(2-5(4)19)6(7)10(8,15)12(11,17)18/h3-7H,1-2H2/t3-,4-,5-,6-,7-,10+,11+/m1/s1 |
| InChIKey | NLGITZRGNAIORZ-RBSKTQHPSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.83 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|