C15H24F3N3S — CID 98478473
1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]thiourea (PubChem CID 98478473) has the molecular formula C15H24F3N3S and a molecular weight of 335.44 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]thiourea |
|---|---|
| PubChem CID | 98478473 |
| Molecular Formula | C15H24F3N3S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]thiourea |
| SMILES | FC(F)(F)CN1CCC(NC(=S)N[C@H]2C[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C15H24F3N3S/c16-15(17,18)9-21-5-3-12(4-6-21)19-14(22)20-13-8-10-1-2-11(13)7-10/h10-13H,1-9H2,(H2,19,20,22)/t10-,11-,13-/m0/s1 |
| InChIKey | MAYNDVWDTLQEMC-GVXVVHGQSA-N |
| XLogP | 2.67 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|