C20H13Br2N3O3S — CID 98482701
(5R,10bS)-7,9-dibromo-5-(3-nitrophenyl)-2-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 98482701) has the molecular formula C20H13Br2N3O3S and a molecular weight of 535.22 g/mol. Its IUPAC name is (5R,10bS)-7,9-dibromo-5-(3-nitrophenyl)-2-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | (5R,10bS)-7,9-dibromo-5-(3-nitrophenyl)-2-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 98482701 |
| Molecular Formula | C20H13Br2N3O3S |
| Molecular Weight | 535.22 g/mol |
| Exact Mass | 532.90 |
| IUPAC Name | (5R,10bS)-7,9-dibromo-5-(3-nitrophenyl)-2-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | O=[N+]([O-])c1cccc([C@H]2Oc3c(Br)cc(Br)cc3[C@@H]3CC(c4cccs4)=NN23)c1 |
| InChI | InChI=1S/C20H13Br2N3O3S/c21-12-8-14-17-10-16(18-5-2-6-29-18)23-24(17)20(28-19(14)15(22)9-12)11-3-1-4-13(7-11)25(26)27/h1-9,17,20H,10H2/t17-,20+/m0/s1 |
| InChIKey | RSJWNQIHNYGAIO-FXAWDEMLSA-N |
| XLogP | 6.42 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.22 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|