C12H6Cl8O3 — CID 98483372
(1R,2S,6S,7R)-1,2,4,5,6,7,8,9-octachloro-10,10-dimethoxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 98483372) has the molecular formula C12H6Cl8O3 and a molecular weight of 481.80 g/mol. Its IUPAC name is (1R,2S,6S,7R)-1,2,4,5,6,7,8,9-octachloro-10,10-dimethoxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1R,2S,6S,7R)-1,2,4,5,6,7,8,9-octachloro-10,10-dimethoxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 98483372 |
| Molecular Formula | C12H6Cl8O3 |
| Molecular Weight | 481.80 g/mol |
| Exact Mass | 477.78 |
| IUPAC Name | (1R,2S,6S,7R)-1,2,4,5,6,7,8,9-octachloro-10,10-dimethoxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | COC1(OC)[C@@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)[C@@]1(Cl)C(Cl)=C(Cl)C(=O)[C@@]12Cl |
| InChI | InChI=1S/C12H6Cl8O3/c1-22-12(23-2)9(18)5(15)6(16)10(12,19)11(20)7(21)3(13)4(14)8(9,11)17/h1-2H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | VIWDWEHVBQLRMO-LNFKQOIKSA-N |
| XLogP | 4.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.80 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|