About (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one
(2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one (PubChem CID 98484640) has the molecular formula C16H12N2O3
and a molecular weight of 280.28 g/mol. Its IUPAC name is (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one.
Molecular Properties
| Compound Name | (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one |
| PubChem CID | 98484640 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one |
| SMILES | O=C1C2=C(Nc3ccccc3N2)O[C@H]1c1ccccc1O |
| InChI | InChI=1S/C16H12N2O3/c19-12-8-4-1-5-9(12)15-14(20)13-16(21-15)18-11-7-3-2-6-10(11)17-13/h1-8,15,17-19H/t15-/m0/s1 |
| InChIKey | SZBSSZITMHUOHY-HNNXBMFYSA-N |
| XLogP | 2.74 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one?
The IUPAC name of (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one (CID 98484640) is (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one.
What is the SMILES notation for (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one?
The canonical SMILES for (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one is O=C1C2=C(Nc3ccccc3N2)O[C@H]1c1ccccc1O.
What is the InChIKey of (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one?
The InChIKey is SZBSSZITMHUOHY-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H12N2O3/c19-12-8-4-1-5-9(12)15-14(20)13-16(21-15)18-11-7-3-2-6-10(11)17-13/h1-8,15,17-19H/t15-/m0/s1.
What are the key properties of (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one?
(2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one has a molecular weight of 280.28 g/mol, XLogP of 2.74, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2-hydroxyphenyl)-4,9-dihydrofuro[3,2-b]quinoxalin-3-one is sourced from PubChem (CID 98484640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).