C15H14O5 — CID 98487675
dimethyl (1R,8R)-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate (PubChem CID 98487675) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is dimethyl (1R,8R)-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate.
| Compound Name | dimethyl (1R,8R)-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 98487675 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | dimethyl (1R,8R)-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(C)O[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C15H14O5/c1-15-9-7-5-4-6-8(9)12(20-15)10(13(16)18-2)11(15)14(17)19-3/h4-7,12H,1-3H3/t12-,15-/m1/s1 |
| InChIKey | PHLHRRGCRJNDPH-IUODEOHRSA-N |
| XLogP | 1.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |