About 1,1-difluoroheptane
1,1-difluoroheptane (PubChem CID 9849) has the molecular formula C7H14F2
and a molecular weight of 136.19 g/mol. Its IUPAC name is 1,1-difluoroheptane.
Molecular Properties
| Compound Name | 1,1-difluoroheptane |
| PubChem CID | 9849 |
| Molecular Formula | C7H14F2 |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.11 |
| IUPAC Name | 1,1-difluoroheptane |
| SMILES | CCCCCCC(F)F |
| InChI | InChI=1S/C7H14F2/c1-2-3-4-5-6-7(8)9/h7H,2-6H2,1H3 |
| InChIKey | GMAOOXCCDVIMBA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoroheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroheptane?
The IUPAC name of 1,1-difluoroheptane (CID 9849) is 1,1-difluoroheptane.
What is the SMILES notation for 1,1-difluoroheptane?
The canonical SMILES for 1,1-difluoroheptane is CCCCCCC(F)F.
What is the InChIKey of 1,1-difluoroheptane?
The InChIKey is GMAOOXCCDVIMBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F2/c1-2-3-4-5-6-7(8)9/h7H,2-6H2,1H3.
What are the key properties of 1,1-difluoroheptane?
1,1-difluoroheptane has a molecular weight of 136.19 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroheptane is sourced from PubChem (CID 9849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).