About ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate
ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate (PubChem CID 98501114) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate |
| PubChem CID | 98501114 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate |
| SMILES | CCOC(=O)/C(=C(/C)N)[C@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C10H14N2O4/c1-3-16-10(15)8(5(2)11)6-4-7(13)12-9(6)14/h6H,3-4,11H2,1-2H3,(H,12,13,14)/b8-5-/t6-/m1/s1 |
| InChIKey | QRIKHIZFBIVKFV-ZQOTZMJXSA-N |
| XLogP | -0.56 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate?
The IUPAC name of ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate (CID 98501114) is ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate.
What is the SMILES notation for ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate?
The canonical SMILES for ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate is CCOC(=O)/C(=C(/C)N)[C@H]1CC(=O)NC1=O.
What is the InChIKey of ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate?
The InChIKey is QRIKHIZFBIVKFV-ZQOTZMJXSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-3-16-10(15)8(5(2)11)6-4-7(13)12-9(6)14/h6H,3-4,11H2,1-2H3,(H,12,13,14)/b8-5-/t6-/m1/s1.
What are the key properties of ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate?
ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate has a molecular weight of 226.23 g/mol, XLogP of -0.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-3-amino-2-[(3R)-2,5-dioxopyrrolidin-3-yl]but-2-enoate is sourced from PubChem (CID 98501114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).