C17H17N5O2 — CID 98505051
(Z,2R)-2-cyano-3-oxo-N-pyridin-2-yl-5-(1,3,5-trimethylpyrazol-4-yl)pent-4-enamide (PubChem CID 98505051) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is (Z,2R)-2-cyano-3-oxo-N-pyridin-2-yl-5-(1,3,5-trimethylpyrazol-4-yl)pent-4-enamide.
| Compound Name | (Z,2R)-2-cyano-3-oxo-N-pyridin-2-yl-5-(1,3,5-trimethylpyrazol-4-yl)pent-4-enamide |
|---|---|
| PubChem CID | 98505051 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (Z,2R)-2-cyano-3-oxo-N-pyridin-2-yl-5-(1,3,5-trimethylpyrazol-4-yl)pent-4-enamide |
| SMILES | Cc1nn(C)c(C)c1/C=C\C(=O)[C@@H](C#N)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C17H17N5O2/c1-11-13(12(2)22(3)21-11)7-8-15(23)14(10-18)17(24)20-16-6-4-5-9-19-16/h4-9,14H,1-3H3,(H,19,20,24)/b8-7-/t14-/m1/s1 |
| InChIKey | VALDTBDYGOXQQC-WBTMPAOCSA-N |
| XLogP | 1.79 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|