About 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol
4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol (PubChem CID 98505517) has the molecular formula C20H32Cl4N2O2
and a molecular weight of 474.30 g/mol. Its IUPAC name is 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol |
| PubChem CID | 98505517 |
| Molecular Formula | C20H32Cl4N2O2 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol |
| SMILES | C[C@@H](Cl)CN(Cc1cc(CN(C[C@@H](C)Cl)C[C@@H](C)Cl)c(O)cc1O)C[C@@H](C)Cl |
| InChI | InChI=1S/C20H32Cl4N2O2/c1-13(21)7-25(8-14(2)22)11-17-5-18(20(28)6-19(17)27)12-26(9-15(3)23)10-16(4)24/h5-6,13-16,27-28H,7-12H2,1-4H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | WNASTKNKLFHUNC-KLHDSHLOSA-N |
| XLogP | 5.21 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol?
The IUPAC name of 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol (CID 98505517) is 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol.
What is the SMILES notation for 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol?
The canonical SMILES for 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol is C[C@@H](Cl)CN(Cc1cc(CN(C[C@@H](C)Cl)C[C@@H](C)Cl)c(O)cc1O)C[C@@H](C)Cl.
What is the InChIKey of 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol?
The InChIKey is WNASTKNKLFHUNC-KLHDSHLOSA-N. The full InChI is InChI=1S/C20H32Cl4N2O2/c1-13(21)7-25(8-14(2)22)11-17-5-18(20(28)6-19(17)27)12-26(9-15(3)23)10-16(4)24/h5-6,13-16,27-28H,7-12H2,1-4H3/t13-,14-,15-,16-/m1/s1.
What are the key properties of 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol?
4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol has a molecular weight of 474.30 g/mol, XLogP of 5.21, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis[[bis[(2R)-2-chloropropyl]amino]methyl]benzene-1,3-diol is sourced from PubChem (CID 98505517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).