C16H32N12 — CID 98508713
1,2,3-tris[(E)-[(2S)-piperazin-2-yl]methylideneamino]guanidine (PubChem CID 98508713) has the molecular formula C16H32N12 and a molecular weight of 392.52 g/mol. Its IUPAC name is 1,2,3-tris[(E)-[(2S)-piperazin-2-yl]methylideneamino]guanidine.
| Compound Name | 1,2,3-tris[(E)-[(2S)-piperazin-2-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 98508713 |
| Molecular Formula | C16H32N12 |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 1,2,3-tris[(E)-[(2S)-piperazin-2-yl]methylideneamino]guanidine |
| SMILES | C(=N/N=C(N/N=C/[C@@H]1CNCCN1)N/N=C/[C@@H]1CNCCN1)\[C@@H]1CNCCN1 |
| InChI | InChI=1S/C16H32N12/c1-4-20-13(7-17-1)10-23-26-16(27-24-11-14-8-18-2-5-21-14)28-25-12-15-9-19-3-6-22-15/h10-15,17-22H,1-9H2,(H2,26,27,28)/b23-10+,24-11+,25-12+/t13-,14-,15-/m0/s1 |
| InChIKey | LEGQAFLDMAKIBJ-LZZFSPNCSA-N |
| XLogP | -3.84 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|