C19H28O3 — CID 98509916
(1S,2S,5R,6S,9S,10S,11R)-6-hydroxy-1,5,11-trimethyl-17-oxatetracyclo[10.4.1.02,10.05,9]heptadec-12-en-14-one (PubChem CID 98509916) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1S,2S,5R,6S,9S,10S,11R)-6-hydroxy-1,5,11-trimethyl-17-oxatetracyclo[10.4.1.02,10.05,9]heptadec-12-en-14-one.
| Compound Name | (1S,2S,5R,6S,9S,10S,11R)-6-hydroxy-1,5,11-trimethyl-17-oxatetracyclo[10.4.1.02,10.05,9]heptadec-12-en-14-one |
|---|---|
| PubChem CID | 98509916 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1S,2S,5R,6S,9S,10S,11R)-6-hydroxy-1,5,11-trimethyl-17-oxatetracyclo[10.4.1.02,10.05,9]heptadec-12-en-14-one |
| SMILES | C[C@H]1C2=CC(=O)CC[C@](C)(O2)[C@H]2CC[C@@]3(C)[C@@H](O)CC[C@H]3[C@@H]12 |
| InChI | InChI=1S/C19H28O3/c1-11-15-10-12(20)6-9-19(3,22-15)14-7-8-18(2)13(17(11)14)4-5-16(18)21/h10-11,13-14,16-17,21H,4-9H2,1-3H3/t11-,13-,14-,16-,17+,18+,19-/m0/s1 |
| InChIKey | XVUYQLZEPVZWCY-WOQHHHGVSA-N |
| XLogP | 3.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |