C13H12BrNO5 — CID 98511099
1-[(1R,2S,6R,7R,8S,9S)-9-bromo-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl]pyrrolidine-2,5-dione (PubChem CID 98511099) has the molecular formula C13H12BrNO5 and a molecular weight of 342.15 g/mol. Its IUPAC name is 1-[(1R,2S,6R,7R,8S,9S)-9-bromo-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(1R,2S,6R,7R,8S,9S)-9-bromo-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98511099 |
| Molecular Formula | C13H12BrNO5 |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 1-[(1R,2S,6R,7R,8S,9S)-9-bromo-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1OC(=O)[C@@H]2[C@H]3C[C@H]([C@@H]12)[C@H](N1C(=O)CCC1=O)[C@H]3Br |
| InChI | InChI=1S/C13H12BrNO5/c14-10-4-3-5(9-8(4)12(18)20-13(9)19)11(10)15-6(16)1-2-7(15)17/h4-5,8-11H,1-3H2/t4-,5-,8-,9-,10+,11+/m1/s1 |
| InChIKey | MBWCUAKFJQZPGF-MXLMMNQCSA-N |
| XLogP | 0.23 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|