C21H17N3O4 — CID 98511356
(1R,8S,9S,13S)-8-methyl-10,12,15-trioxo-1-phenyl-11,14-diazatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-11-carboxamide (PubChem CID 98511356) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is (1R,8S,9S,13S)-8-methyl-10,12,15-trioxo-1-phenyl-11,14-diazatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-11-carboxamide.
| Compound Name | (1R,8S,9S,13S)-8-methyl-10,12,15-trioxo-1-phenyl-11,14-diazatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-11-carboxamide |
|---|---|
| PubChem CID | 98511356 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (1R,8S,9S,13S)-8-methyl-10,12,15-trioxo-1-phenyl-11,14-diazatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-11-carboxamide |
| SMILES | C[C@@]12C(=O)N[C@](c3ccccc3)(c3ccccc31)[C@H]1C(=O)N(C(N)=O)C(=O)[C@@H]12 |
| InChI | InChI=1S/C21H17N3O4/c1-20-12-9-5-6-10-13(12)21(23-18(20)27,11-7-3-2-4-8-11)15-14(20)16(25)24(17(15)26)19(22)28/h2-10,14-15H,1H3,(H2,22,28)(H,23,27)/t14-,15-,20-,21-/m1/s1 |
| InChIKey | OMATZYZZDMPOPF-MXKXFIQMSA-N |
| XLogP | 1.01 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|