C26H48N10O5 — CID 9851234
cyclo[Ala-Lys-Lys-Arg-D-Pro] (PubChem CID 9851234) has the molecular formula C26H48N10O5 and a molecular weight of 580.70 g/mol. Its IUPAC name is 2-[3-[(3S,6S,9S,12S,15R)-6,9-bis(4-aminobutyl)-12-methyl-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]propyl]guanidine.
| Compound Name | cyclo[Ala-Lys-Lys-Arg-D-Pro] |
|---|---|
| PubChem CID | 9851234 |
| Molecular Formula | C26H48N10O5 |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | 2-[3-[(3S,6S,9S,12S,15R)-6,9-bis(4-aminobutyl)-12-methyl-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]propyl]guanidine |
| SMILES | C[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2CCC[C@@H]2C(=O)N1)CCCN=C(N)N)CCCCN)CCCCN |
| InChI | InChI=1S/C26H48N10O5/c1-16-21(37)33-17(8-2-4-12-27)22(38)34-18(9-3-5-13-28)23(39)35-19(10-6-14-31-26(29)30)25(41)36-15-7-11-20(36)24(40)32-16/h16-20H,2-15,27-28H2,1H3,(H,32,40)(H,33,37)(H,34,38)(H,35,39)(H4,29,30,31)/t16-,17-,18-,19-,20+/m0/s1 |
| InChIKey | QFNKBJOQENURER-VYJAJWGXSA-N |
| XLogP | -2.60 |
| TPSA | 253.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | 942 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|