C11H20NO3+ — CID 98513325
(1R,5R,6R,7S)-6,7-dimethoxy-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-one (PubChem CID 98513325) has the molecular formula C11H20NO3+ and a molecular weight of 214.28 g/mol. Its IUPAC name is (1R,5R,6R,7S)-6,7-dimethoxy-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,5R,6R,7S)-6,7-dimethoxy-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 98513325 |
| Molecular Formula | C11H20NO3+ |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (1R,5R,6R,7S)-6,7-dimethoxy-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-one |
| SMILES | CO[C@@H]1[C@H](OC)[C@H]2CC(=O)C[C@H]1[N+]2(C)C |
| InChI | InChI=1S/C11H20NO3/c1-12(2)8-5-7(13)6-9(12)11(15-4)10(8)14-3/h8-11H,5-6H2,1-4H3/q+1/t8-,9-,10-,11+/m1/s1 |
| InChIKey | HWLHUCCBZFCIKY-DBIOUOCHSA-N |
| XLogP | 0.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|