C15H16N2O3 — CID 98514185
(1R,2R,4S)-N-(3-nitrophenyl)bicyclo[2.2.2]oct-5-ene-2-carboxamide (PubChem CID 98514185) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is (1R,2R,4S)-N-(3-nitrophenyl)bicyclo[2.2.2]oct-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4S)-N-(3-nitrophenyl)bicyclo[2.2.2]oct-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98514185 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (1R,2R,4S)-N-(3-nitrophenyl)bicyclo[2.2.2]oct-5-ene-2-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)[C@@H]1C[C@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C15H16N2O3/c18-15(14-8-10-4-6-11(14)7-5-10)16-12-2-1-3-13(9-12)17(19)20/h1-4,6,9-11,14H,5,7-8H2,(H,16,18)/t10-,11-,14+/m0/s1 |
| InChIKey | REDHCJABWWWJOG-COPLHBTASA-N |
| XLogP | 3.14 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|