C14H12BrN — CID 98514546
(1R,2R,3R,4S,5S,6R)-5-(4-bromophenyl)tricyclo[2.2.1.02,6]heptane-3-carbonitrile (PubChem CID 98514546) has the molecular formula C14H12BrN and a molecular weight of 274.16 g/mol. Its IUPAC name is (1R,2R,3R,4S,5S,6R)-5-(4-bromophenyl)tricyclo[2.2.1.02,6]heptane-3-carbonitrile.
| Compound Name | (1R,2R,3R,4S,5S,6R)-5-(4-bromophenyl)tricyclo[2.2.1.02,6]heptane-3-carbonitrile |
|---|---|
| PubChem CID | 98514546 |
| Molecular Formula | C14H12BrN |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | (1R,2R,3R,4S,5S,6R)-5-(4-bromophenyl)tricyclo[2.2.1.02,6]heptane-3-carbonitrile |
| SMILES | N#C[C@@H]1[C@H]2C[C@H]3[C@@H]1[C@@H]3[C@H]2c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H12BrN/c15-8-3-1-7(2-4-8)12-9-5-10-13(14(10)12)11(9)6-16/h1-4,9-14H,5H2/t9-,10+,11-,12+,13+,14+/m1/s1 |
| InChIKey | CNVRHLPCLSZXRL-QUGYJXMDSA-N |
| XLogP | 3.57 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |