C21H24N2O — CID 98514778
(1R,12R,13R,14E,19S,21S)-14-ethylidene-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2,4,6-trien-9-one (PubChem CID 98514778) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is (1R,12R,13R,14E,19S,21S)-14-ethylidene-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2,4,6-trien-9-one.
| Compound Name | (1R,12R,13R,14E,19S,21S)-14-ethylidene-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 98514778 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (1R,12R,13R,14E,19S,21S)-14-ethylidene-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2,4,6-trien-9-one |
| SMILES | C/C=C1/CN2CC[C@]34c5ccccc5N5C(=O)CC[C@@H]([C@H]53)[C@H]1C[C@H]24 |
| InChI | InChI=1S/C21H24N2O/c1-2-13-12-22-10-9-21-16-5-3-4-6-17(16)23-19(24)8-7-14(20(21)23)15(13)11-18(21)22/h2-6,14-15,18,20H,7-12H2,1H3/b13-2-/t14-,15+,18+,20+,21-/m1/s1 |
| InChIKey | GLXCOWMFBYYQSW-SYNXJLQBSA-N |
| XLogP | 3.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|