C10H6Br2O2 — CID 98514879
(1R,2R,3R,4R,5S,7R,8R,9R)-5,9-dibromopentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-dione (PubChem CID 98514879) has the molecular formula C10H6Br2O2 and a molecular weight of 317.96 g/mol. Its IUPAC name is (1R,2R,3R,4R,5S,7R,8R,9R)-5,9-dibromopentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-dione.
| Compound Name | (1R,2R,3R,4R,5S,7R,8R,9R)-5,9-dibromopentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-dione |
|---|---|
| PubChem CID | 98514879 |
| Molecular Formula | C10H6Br2O2 |
| Molecular Weight | 317.96 g/mol |
| Exact Mass | 315.87 |
| IUPAC Name | (1R,2R,3R,4R,5S,7R,8R,9R)-5,9-dibromopentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-dione |
| SMILES | O=C1[C@@H]2[C@H]3C(=O)[C@]4(Br)[C@H]5[C@@H]([C@@H]24)[C@@]1(Br)[C@H]35 |
| InChI | InChI=1S/C10H6Br2O2/c11-9-3-1-2(8(9)14)4-6(9)5(3)10(4,12)7(1)13/h1-6H/t1-,2-,3-,4-,5-,6-,9-,10+/m1/s1 |
| InChIKey | BPIHMPOUHNUKRN-JHRNPDIFSA-N |
| XLogP | 1.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.96 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|