C16H14Cl2N2O3 — CID 98517028
(2R)-N'-(2,2-dichloroacetyl)-2-phenoxy-2-phenylacetohydrazide (PubChem CID 98517028) has the molecular formula C16H14Cl2N2O3 and a molecular weight of 353.21 g/mol. Its IUPAC name is (2R)-N'-(2,2-dichloroacetyl)-2-phenoxy-2-phenylacetohydrazide.
| Compound Name | (2R)-N'-(2,2-dichloroacetyl)-2-phenoxy-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 98517028 |
| Molecular Formula | C16H14Cl2N2O3 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (2R)-N'-(2,2-dichloroacetyl)-2-phenoxy-2-phenylacetohydrazide |
| SMILES | O=C(NNC(=O)[C@H](Oc1ccccc1)c1ccccc1)C(Cl)Cl |
| InChI | InChI=1S/C16H14Cl2N2O3/c17-14(18)16(22)20-19-15(21)13(11-7-3-1-4-8-11)23-12-9-5-2-6-10-12/h1-10,13-14H,(H,19,21)(H,20,22)/t13-/m1/s1 |
| InChIKey | NMKLUIWWTBULQP-CYBMUJFWSA-N |
| XLogP | 2.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|