C11H18N4O2S — CID 98517976
(2S)-2-(cyclopropylmethoxy)-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]propanamide (PubChem CID 98517976) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is (2S)-2-(cyclopropylmethoxy)-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]propanamide.
| Compound Name | (2S)-2-(cyclopropylmethoxy)-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 98517976 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (2S)-2-(cyclopropylmethoxy)-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]propanamide |
| SMILES | C[C@H](OCC1CC1)C(=O)NCc1n[nH]c(=S)n1C |
| InChI | InChI=1S/C11H18N4O2S/c1-7(17-6-8-3-4-8)10(16)12-5-9-13-14-11(18)15(9)2/h7-8H,3-6H2,1-2H3,(H,12,16)(H,14,18)/t7-/m0/s1 |
| InChIKey | MBAQTVHAMXXHRW-ZETCQYMHSA-N |
| XLogP | 0.91 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|