C19H10Cl8O4 — CID 98519441
(1'S,2'R,3'R,6'R,7'R,9'S,10'S,14'R)-3',4',5',6',10',11',12',14'-octachlorospiro[1,3-dioxolane-2,17'-pentacyclo[7.5.2.13,6.02,7.010,14]heptadeca-4,11,15-triene]-8',13'-dione (PubChem CID 98519441) has the molecular formula C19H10Cl8O4 and a molecular weight of 585.91 g/mol. Its IUPAC name is (1'S,2'R,3'R,6'R,7'R,9'S,10'S,14'R)-3',4',5',6',10',11',12',14'-octachlorospiro[1,3-dioxolane-2,17'-pentacyclo[7.5.2.13,6.02,7.010,14]heptadeca-4,11,15-triene]-8',13'-dione.
| Compound Name | (1'S,2'R,3'R,6'R,7'R,9'S,10'S,14'R)-3',4',5',6',10',11',12',14'-octachlorospiro[1,3-dioxolane-2,17'-pentacyclo[7.5.2.13,6.02,7.010,14]heptadeca-4,11,15-triene]-8',13'-dione |
|---|---|
| PubChem CID | 98519441 |
| Molecular Formula | C19H10Cl8O4 |
| Molecular Weight | 585.91 g/mol |
| Exact Mass | 581.81 |
| IUPAC Name | (1'S,2'R,3'R,6'R,7'R,9'S,10'S,14'R)-3',4',5',6',10',11',12',14'-octachlorospiro[1,3-dioxolane-2,17'-pentacyclo[7.5.2.13,6.02,7.010,14]heptadeca-4,11,15-triene]-8',13'-dione |
| SMILES | O=C1[C@H]2[C@@H]([C@@H]3C=C[C@@H]1[C@@]1(Cl)C(Cl)=C(Cl)C(=O)[C@]31Cl)[C@]1(Cl)C(Cl)=C(Cl)[C@]2(Cl)C12OCCO2 |
| InChI | InChI=1S/C19H10Cl8O4/c20-9-11(21)15(24)6-2-1-5(16(15,25)14(9)29)7-8(10(6)28)18(27)13(23)12(22)17(7,26)19(18)30-3-4-31-19/h1-2,5-8H,3-4H2/t5-,6-,7+,8+,15+,16+,17-,18-/m0/s1 |
| InChIKey | ARAXRMVEMCQVIF-QXHTYHGASA-N |
| XLogP | 5.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.91 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|