C14H14Cl6O4 — CID 98519789
(1R,2R,6S,7R)-1,3,4,7,8,9-hexachloro-5,5,10,10-tetramethoxytricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 98519789) has the molecular formula C14H14Cl6O4 and a molecular weight of 458.98 g/mol. Its IUPAC name is (1R,2R,6S,7R)-1,3,4,7,8,9-hexachloro-5,5,10,10-tetramethoxytricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (1R,2R,6S,7R)-1,3,4,7,8,9-hexachloro-5,5,10,10-tetramethoxytricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 98519789 |
| Molecular Formula | C14H14Cl6O4 |
| Molecular Weight | 458.98 g/mol |
| Exact Mass | 455.90 |
| IUPAC Name | (1R,2R,6S,7R)-1,3,4,7,8,9-hexachloro-5,5,10,10-tetramethoxytricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | COC1(OC)C(Cl)=C(Cl)[C@H]2[C@@H]1[C@]1(Cl)C(Cl)=C(Cl)[C@]2(Cl)C1(OC)OC |
| InChI | InChI=1S/C14H14Cl6O4/c1-21-13(22-2)7-5(6(15)8(13)16)11(19)9(17)10(18)12(7,20)14(11,23-3)24-4/h5,7H,1-4H3/t5-,7+,11-,12-/m0/s1 |
| InChIKey | IWSUQJWFHGCBLP-OFJDZMCQSA-N |
| XLogP | 4.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|