C19H22O3 — CID 98521015
(1R,13S,14S)-14-hydroxy-6-methoxy-14-methyltetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),5(10),6,8-tetraen-17-one (PubChem CID 98521015) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (1R,13S,14S)-14-hydroxy-6-methoxy-14-methyltetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),5(10),6,8-tetraen-17-one.
| Compound Name | (1R,13S,14S)-14-hydroxy-6-methoxy-14-methyltetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),5(10),6,8-tetraen-17-one |
|---|---|
| PubChem CID | 98521015 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (1R,13S,14S)-14-hydroxy-6-methoxy-14-methyltetracyclo[11.3.1.02,11.05,10]heptadeca-2(11),5(10),6,8-tetraen-17-one |
| SMILES | COc1cccc2c1CCC1=C2C[C@@H]2C(=O)[C@@H]1CC[C@]2(C)O |
| InChI | InChI=1S/C19H22O3/c1-19(21)9-8-14-12-6-7-13-11(4-3-5-17(13)22-2)15(12)10-16(19)18(14)20/h3-5,14,16,21H,6-10H2,1-2H3/t14-,16-,19+/m1/s1 |
| InChIKey | WCNGKBPWGBDINX-OGWOLHLISA-N |
| XLogP | 3.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |