C20H20N2O5 — CID 98521150
N-(1,3-benzodioxol-5-yl)-3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]propanamide (PubChem CID 98521150) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]propanamide |
|---|---|
| PubChem CID | 98521150 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]propanamide |
| SMILES | O=C(CCN1C(=O)[C@H]2[C@H](C1=O)[C@H]1C=C[C@H]2CC1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20N2O5/c23-16(21-13-5-6-14-15(9-13)27-10-26-14)7-8-22-19(24)17-11-1-2-12(4-3-11)18(17)20(22)25/h1-2,5-6,9,11-12,17-18H,3-4,7-8,10H2,(H,21,23)/t11-,12-,17+,18+/m0/s1 |
| InChIKey | ULZHQMURVVZPHP-YDOWWZDFSA-N |
| XLogP | 1.94 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|