C16H14N2O4 — CID 98521435
(3aR,4S,7S,7aS)-2-[(E)-(2-methoxyphenyl)methylideneamino]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98521435) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is (3aR,4S,7S,7aS)-2-[(E)-(2-methoxyphenyl)methylideneamino]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7S,7aS)-2-[(E)-(2-methoxyphenyl)methylideneamino]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98521435 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (3aR,4S,7S,7aS)-2-[(E)-(2-methoxyphenyl)methylideneamino]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | COc1ccccc1/C=N/N1C(=O)[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C16H14N2O4/c1-21-10-5-3-2-4-9(10)8-17-18-15(19)13-11-6-7-12(22-11)14(13)16(18)20/h2-8,11-14H,1H3/b17-8+/t11-,12-,13-,14+/m0/s1 |
| InChIKey | UTPFDKXWTHZKKP-UOYSOXIMSA-N |
| XLogP | 0.97 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|