C15H12O4 — CID 98523322
(3aR,9aR)-3-acetyl-2-methyl-3a,9a-dihydrobenzo[f][1]benzofuran-4,9-dione (PubChem CID 98523322) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is (3aR,9aR)-3-acetyl-2-methyl-3a,9a-dihydrobenzo[f][1]benzofuran-4,9-dione.
| Compound Name | (3aR,9aR)-3-acetyl-2-methyl-3a,9a-dihydrobenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 98523322 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (3aR,9aR)-3-acetyl-2-methyl-3a,9a-dihydrobenzo[f][1]benzofuran-4,9-dione |
| SMILES | CC(=O)C1=C(C)O[C@H]2C(=O)c3ccccc3C(=O)[C@H]12 |
| InChI | InChI=1S/C15H12O4/c1-7(16)11-8(2)19-15-12(11)13(17)9-5-3-4-6-10(9)14(15)18/h3-6,12,15H,1-2H3/t12-,15+/m0/s1 |
| InChIKey | CJOVSJRMDUMRKK-SWLSCSKDSA-N |
| XLogP | 1.94 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|