C24H20N2 — CID 98523863
(2S,7S,8R)-2,6,8-triphenyl-1,5-diazabicyclo[5.1.0]octa-3,5-diene (PubChem CID 98523863) has the molecular formula C24H20N2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (2S,7S,8R)-2,6,8-triphenyl-1,5-diazabicyclo[5.1.0]octa-3,5-diene.
| Compound Name | (2S,7S,8R)-2,6,8-triphenyl-1,5-diazabicyclo[5.1.0]octa-3,5-diene |
|---|---|
| PubChem CID | 98523863 |
| Molecular Formula | C24H20N2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2S,7S,8R)-2,6,8-triphenyl-1,5-diazabicyclo[5.1.0]octa-3,5-diene |
| SMILES | C1=C[C@@H](c2ccccc2)N2[C@H](C(c3ccccc3)=N1)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C24H20N2/c1-4-10-18(11-5-1)21-16-17-25-22(19-12-6-2-7-13-19)24-23(26(21)24)20-14-8-3-9-15-20/h1-17,21,23-24H/t21-,23+,24+,26?/m0/s1 |
| InChIKey | JPUIYIOUQXRCMW-JVFCRGKHSA-N |
| XLogP | 5.17 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|