C12H21N3O — CID 98523899
[(E)-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methylideneamino]urea (PubChem CID 98523899) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is [(E)-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methylideneamino]urea.
| Compound Name | [(E)-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methylideneamino]urea |
|---|---|
| PubChem CID | 98523899 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | [(E)-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methylideneamino]urea |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)[C@H](/C=N/NC(N)=O)C2 |
| InChI | InChI=1S/C12H21N3O/c1-11(2)8-4-5-12(11,3)9(6-8)7-14-15-10(13)16/h7-9H,4-6H2,1-3H3,(H3,13,15,16)/b14-7+/t8-,9+,12-/m1/s1 |
| InChIKey | YLVNMDLQYFEFCH-WRXSIDQWSA-N |
| XLogP | 2.10 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|