C9H18O11S3 — CID 98524476
[(3R,4R,5S,6S)-6-methoxy-4,5-bis(methylsulfonyloxy)oxan-3-yl] methanesulfonate (PubChem CID 98524476) has the molecular formula C9H18O11S3 and a molecular weight of 398.43 g/mol. Its IUPAC name is [(3R,4R,5S,6S)-6-methoxy-4,5-bis(methylsulfonyloxy)oxan-3-yl] methanesulfonate.
| Compound Name | [(3R,4R,5S,6S)-6-methoxy-4,5-bis(methylsulfonyloxy)oxan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 98524476 |
| Molecular Formula | C9H18O11S3 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | [(3R,4R,5S,6S)-6-methoxy-4,5-bis(methylsulfonyloxy)oxan-3-yl] methanesulfonate |
| SMILES | CO[C@H]1OC[C@@H](OS(C)(=O)=O)[C@@H](OS(C)(=O)=O)[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C9H18O11S3/c1-16-9-8(20-23(4,14)15)7(19-22(3,12)13)6(5-17-9)18-21(2,10)11/h6-9H,5H2,1-4H3/t6-,7-,8+,9+/m1/s1 |
| InChIKey | RNDIQRDPULGKSW-HXFLIBJXSA-N |
| XLogP | -1.98 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|