C8H17NO2 — CID 98524716
(3R,4E)-4-hydroxyimino-2,2,3-trimethylpentan-3-ol (PubChem CID 98524716) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (3R,4E)-4-hydroxyimino-2,2,3-trimethylpentan-3-ol.
| Compound Name | (3R,4E)-4-hydroxyimino-2,2,3-trimethylpentan-3-ol |
|---|---|
| PubChem CID | 98524716 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (3R,4E)-4-hydroxyimino-2,2,3-trimethylpentan-3-ol |
| SMILES | C/C(=N\O)[C@](C)(O)C(C)(C)C |
| InChI | InChI=1S/C8H17NO2/c1-6(9-11)8(5,10)7(2,3)4/h10-11H,1-5H3/b9-6+/t8-/m0/s1 |
| InChIKey | QGRRJPVHBNXKQB-CYXIBPNKSA-N |
| XLogP | 1.63 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|