C16H19NO2 — CID 98524807
(1R,2S,7R,8R)-4-piperidin-1-yltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 98524807) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (1R,2S,7R,8R)-4-piperidin-1-yltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1R,2S,7R,8R)-4-piperidin-1-yltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 98524807 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (1R,2S,7R,8R)-4-piperidin-1-yltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | O=C1C(N2CCCCC2)=CC(=O)[C@H]2[C@@H]1[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C16H19NO2/c18-13-9-12(17-6-2-1-3-7-17)16(19)15-11-5-4-10(8-11)14(13)15/h4-5,9-11,14-15H,1-3,6-8H2/t10-,11-,14-,15-/m0/s1 |
| InChIKey | ISAAUTCGJPKCCT-GVARAGBVSA-N |
| XLogP | 1.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|