C11H12O6 — CID 98525273
(1S,2R,6S,7R)-1-(1,3-dioxolan-2-yl)-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98525273) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is (1S,2R,6S,7R)-1-(1,3-dioxolan-2-yl)-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-1-(1,3-dioxolan-2-yl)-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98525273 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (1S,2R,6S,7R)-1-(1,3-dioxolan-2-yl)-4,10-dioxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1OC(=O)[C@@H]2[C@H]1[C@H]1CC[C@]2(C2OCCO2)O1 |
| InChI | InChI=1S/C11H12O6/c12-8-6-5-1-2-11(17-5,7(6)9(13)16-8)10-14-3-4-15-10/h5-7,10H,1-4H2/t5-,6-,7+,11+/m1/s1 |
| InChIKey | OZDFFVFBEAMTHZ-MNRJBDMISA-N |
| XLogP | -0.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|