C18H24O6 — CID 98525627
cis-diethyl (1S,3R)-2-[(1R)-cyclohex-3-en-1-yl]-4,6-dioxocyclohexane-1,3-dicarboxylate (PubChem CID 98525627) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is cis-diethyl (1S,3R)-2-[(1R)-cyclohex-3-en-1-yl]-4,6-dioxocyclohexane-1,3-dicarboxylate.
| Compound Name | cis-diethyl (1S,3R)-2-[(1R)-cyclohex-3-en-1-yl]-4,6-dioxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 98525627 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | cis-diethyl (1S,3R)-2-[(1R)-cyclohex-3-en-1-yl]-4,6-dioxocyclohexane-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)CC(=O)[C@@H](C(=O)OCC)C1[C@H]1CC=CCC1 |
| InChI | InChI=1S/C18H24O6/c1-3-23-17(21)15-12(19)10-13(20)16(18(22)24-4-2)14(15)11-8-6-5-7-9-11/h5-6,11,14-16H,3-4,7-10H2,1-2H3/t11-,14?,15-,16+/m0/s1 |
| InChIKey | LOOXMNQJBANMLJ-RJPYNODJSA-N |
| XLogP | 1.86 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|