C17H18N4O2 — CID 98525887
(Z)-N-[(3S)-1-(1-methylpyrazol-4-yl)-2-oxopyrrolidin-3-yl]-3-phenylprop-2-enamide (PubChem CID 98525887) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is (Z)-N-[(3S)-1-(1-methylpyrazol-4-yl)-2-oxopyrrolidin-3-yl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[(3S)-1-(1-methylpyrazol-4-yl)-2-oxopyrrolidin-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 98525887 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (Z)-N-[(3S)-1-(1-methylpyrazol-4-yl)-2-oxopyrrolidin-3-yl]-3-phenylprop-2-enamide |
| SMILES | Cn1cc(N2CC[C@H](NC(=O)/C=C\c3ccccc3)C2=O)cn1 |
| InChI | InChI=1S/C17H18N4O2/c1-20-12-14(11-18-20)21-10-9-15(17(21)23)19-16(22)8-7-13-5-3-2-4-6-13/h2-8,11-12,15H,9-10H2,1H3,(H,19,22)/b8-7-/t15-/m0/s1 |
| InChIKey | FPCJQZOMKJGPKA-LZNQSLFOSA-N |
| XLogP | 1.36 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|