About 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol
8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol (PubChem CID 98525976) has the molecular formula C18H37NO
and a molecular weight of 283.50 g/mol. Its IUPAC name is 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol.
Molecular Properties
| Compound Name | 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol |
| PubChem CID | 98525976 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol |
| SMILES | CCCCCCCC[C@H]1N[C@@H]1CCCCCCCCO |
| InChI | InChI=1S/C18H37NO/c1-2-3-4-5-8-11-14-17-18(19-17)15-12-9-6-7-10-13-16-20/h17-20H,2-16H2,1H3/t17-,18-/m1/s1 |
| InChIKey | KESAODXICHRORT-QZTJIDSGSA-N |
| XLogP | 4.80 |
| TPSA | 42.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol?
The IUPAC name of 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol (CID 98525976) is 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol.
What is the SMILES notation for 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol?
The canonical SMILES for 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol is CCCCCCCC[C@H]1N[C@@H]1CCCCCCCCO.
What is the InChIKey of 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol?
The InChIKey is KESAODXICHRORT-QZTJIDSGSA-N. The full InChI is InChI=1S/C18H37NO/c1-2-3-4-5-8-11-14-17-18(19-17)15-12-9-6-7-10-13-16-20/h17-20H,2-16H2,1H3/t17-,18-/m1/s1.
What are the key properties of 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol?
8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol has a molecular weight of 283.50 g/mol, XLogP of 4.80, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2R,3R)-3-octylaziridin-2-yl]octan-1-ol is sourced from PubChem (CID 98525976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).