C17H18N2O6 — CID 98535287
(1aS,2aS,5aR,6aR)-4-[[(1aR,2aR,5aS,6aR)-3,5-dioxo-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindol-4-yl]methyl]-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione (PubChem CID 98535287) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is (1aS,2aS,5aR,6aR)-4-[[(1aR,2aR,5aS,6aR)-3,5-dioxo-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindol-4-yl]methyl]-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione.
| Compound Name | (1aS,2aS,5aR,6aR)-4-[[(1aR,2aR,5aS,6aR)-3,5-dioxo-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindol-4-yl]methyl]-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione |
|---|---|
| PubChem CID | 98535287 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (1aS,2aS,5aR,6aR)-4-[[(1aR,2aR,5aS,6aR)-3,5-dioxo-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindol-4-yl]methyl]-1a,2,2a,5a,6,6a-hexahydrooxireno[2,3-f]isoindole-3,5-dione |
| SMILES | O=C1[C@H]2C[C@@H]3O[C@@H]3C[C@H]2C(=O)N1CN1C(=O)[C@H]2C[C@H]3O[C@@H]3C[C@H]2C1=O |
| InChI | InChI=1S/C17H18N2O6/c20-14-6-1-10-11(24-10)2-7(6)15(21)18(14)5-19-16(22)8-3-12-13(25-12)4-9(8)17(19)23/h6-13H,1-5H2/t6-,7+,8-,9+,10-,11-,12-,13+/m1/s1 |
| InChIKey | HCTKFIVBWHHQBK-NBJMNMEVSA-N |
| XLogP | -0.73 |
| TPSA | 99.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|