C8H8N4O4 — CID 98536404
(1R,6S)-2,4-dimethyl-6-nitro-3,5-dioxo-2,4-diazabicyclo[4.1.0]heptane-1-carbonitrile (PubChem CID 98536404) has the molecular formula C8H8N4O4 and a molecular weight of 224.18 g/mol. Its IUPAC name is (1R,6S)-2,4-dimethyl-6-nitro-3,5-dioxo-2,4-diazabicyclo[4.1.0]heptane-1-carbonitrile.
| Compound Name | (1R,6S)-2,4-dimethyl-6-nitro-3,5-dioxo-2,4-diazabicyclo[4.1.0]heptane-1-carbonitrile |
|---|---|
| PubChem CID | 98536404 |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | (1R,6S)-2,4-dimethyl-6-nitro-3,5-dioxo-2,4-diazabicyclo[4.1.0]heptane-1-carbonitrile |
| SMILES | CN1C(=O)N(C)[C@]2(C#N)C[C@@]2([N+](=O)[O-])C1=O |
| InChI | InChI=1S/C8H8N4O4/c1-10-5(13)8(12(15)16)3-7(8,4-9)11(2)6(10)14/h3H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | YAIVJIIEVSTRGF-JGVFFNPUSA-N |
| XLogP | -0.81 |
| TPSA | 107.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|