C22H26O2 — CID 98536912
(1R,2R,3R,10R,11S,12S)-1,12,14,14,15,16-hexamethyl-17-oxapentacyclo[10.2.2.13,10.02,11.04,9]heptadeca-4,6,8,15-tetraen-13-one (PubChem CID 98536912) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is (1R,2R,3R,10R,11S,12S)-1,12,14,14,15,16-hexamethyl-17-oxapentacyclo[10.2.2.13,10.02,11.04,9]heptadeca-4,6,8,15-tetraen-13-one.
| Compound Name | (1R,2R,3R,10R,11S,12S)-1,12,14,14,15,16-hexamethyl-17-oxapentacyclo[10.2.2.13,10.02,11.04,9]heptadeca-4,6,8,15-tetraen-13-one |
|---|---|
| PubChem CID | 98536912 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (1R,2R,3R,10R,11S,12S)-1,12,14,14,15,16-hexamethyl-17-oxapentacyclo[10.2.2.13,10.02,11.04,9]heptadeca-4,6,8,15-tetraen-13-one |
| SMILES | CC1=C(C)[C@@]2(C)[C@H]3[C@H]([C@H]4O[C@H]3c3ccccc34)[C@]1(C)C(=O)C2(C)C |
| InChI | InChI=1S/C22H26O2/c1-11-12(2)22(6)16-15(21(11,5)19(23)20(22,3)4)17-13-9-7-8-10-14(13)18(16)24-17/h7-10,15-18H,1-6H3/t15-,16+,17+,18+,21-,22+/m1/s1 |
| InChIKey | QSAPPJOAPWZMLU-RZAWSJAESA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|