C12H14BrN3O — CID 98537453
[(Z)-[(1R,2R,3S,5S,6R,7S,8R,9R,10R)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]urea (PubChem CID 98537453) has the molecular formula C12H14BrN3O and a molecular weight of 296.17 g/mol. Its IUPAC name is [(Z)-[(1R,2R,3S,5S,6R,7S,8R,9R,10R)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]urea.
| Compound Name | [(Z)-[(1R,2R,3S,5S,6R,7S,8R,9R,10R)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]urea |
|---|---|
| PubChem CID | 98537453 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | [(Z)-[(1R,2R,3S,5S,6R,7S,8R,9R,10R)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]urea |
| SMILES | NC(=O)N/N=C1/[C@H]2[C@@H]3C[C@H]4[C@H]5[C@H](Br)[C@@H]([C@@H]1[C@@H]35)[C@H]42 |
| InChI | InChI=1S/C12H14BrN3O/c13-10-6-2-1-3-4(6)9-8(10)5(2)7(3)11(9)15-16-12(14)17/h2-10H,1H2,(H3,14,16,17)/b15-11-/t2-,3-,4+,5-,6-,7+,8-,9+,10+/m1/s1 |
| InChIKey | WLDWXNQDVDIUJY-VTUDBUKNSA-N |
| XLogP | 1.16 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|