About (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione
(3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione (PubChem CID 98537630) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione.
Molecular Properties
| Compound Name | (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione |
| PubChem CID | 98537630 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione |
| SMILES | C/C=c1\[nH]c(=O)/c(=C\C=C\C)[nH]c1=O |
| InChI | InChI=1S/C10H12N2O2/c1-3-5-6-8-10(14)11-7(4-2)9(13)12-8/h3-6H,1-2H3,(H,11,14)(H,12,13)/b5-3+,7-4-,8-6+ |
| InChIKey | UHBPRMLPYREFEJ-DIDNWENSSA-N |
| XLogP | -0.78 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione?
The IUPAC name of (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione (CID 98537630) is (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione.
What is the SMILES notation for (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione?
The canonical SMILES for (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione is C/C=c1\[nH]c(=O)/c(=C\C=C\C)[nH]c1=O.
What is the InChIKey of (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione?
The InChIKey is UHBPRMLPYREFEJ-DIDNWENSSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-3-5-6-8-10(14)11-7(4-2)9(13)12-8/h3-6H,1-2H3,(H,11,14)(H,12,13)/b5-3+,7-4-,8-6+.
What are the key properties of (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione?
(3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione has a molecular weight of 192.22 g/mol, XLogP of -0.78, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,6Z)-3-[(E)-but-2-enylidene]-6-ethylidenepiperazine-2,5-dione is sourced from PubChem (CID 98537630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).